C17H26N2O3S — CID 136558862
1-(2-bicyclo[2.2.1]heptanyl)-N-(3-methoxy-1-pyridin-3-ylpropyl)methanesulfonamide (PubChem CID 136558862) has the molecular formula C17H26N2O3S and a molecular weight of 338.47 g/mol. Its IUPAC name is 1-(2-bicyclo[2.2.1]heptanyl)-N-(3-methoxy-1-pyridin-3-ylpropyl)methanesulfonamide.
| Compound Name | 1-(2-bicyclo[2.2.1]heptanyl)-N-(3-methoxy-1-pyridin-3-ylpropyl)methanesulfonamide |
|---|---|
| PubChem CID | 136558862 |
| Molecular Formula | C17H26N2O3S |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 1-(2-bicyclo[2.2.1]heptanyl)-N-(3-methoxy-1-pyridin-3-ylpropyl)methanesulfonamide |
| SMILES | COCCC(NS(=O)(=O)CC1CC2CCC1C2)c1cccnc1 |
| InChI | InChI=1S/C17H26N2O3S/c1-22-8-6-17(15-3-2-7-18-11-15)19-23(20,21)12-16-10-13-4-5-14(16)9-13/h2-3,7,11,13-14,16-17,19H,4-6,8-10,12H2,1H3 |
| InChIKey | ZHIYCQRSDLZMTQ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |