C11H17NO6S2 — CID 75082846
(4-methylsulfonyloxy-4-pyridin-3-ylbutyl) methanesulfonate (PubChem CID 75082846) has the molecular formula C11H17NO6S2 and a molecular weight of 323.39 g/mol. Its IUPAC name is (4-methylsulfonyloxy-4-pyridin-3-ylbutyl) methanesulfonate.
| Compound Name | (4-methylsulfonyloxy-4-pyridin-3-ylbutyl) methanesulfonate |
|---|---|
| PubChem CID | 75082846 |
| Molecular Formula | C11H17NO6S2 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | (4-methylsulfonyloxy-4-pyridin-3-ylbutyl) methanesulfonate |
| SMILES | CS(=O)(=O)OCCCC(OS(C)(=O)=O)c1cccnc1 |
| InChI | InChI=1S/C11H17NO6S2/c1-19(13,14)17-8-4-6-11(18-20(2,15)16)10-5-3-7-12-9-10/h3,5,7,9,11H,4,6,8H2,1-2H3 |
| InChIKey | ZNIVURUYAIQACA-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 99.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|