C16H25NO2Si — CID 91700217
2-bicyclo[2.2.1]heptanylmethoxy-dimethyl-(pyridin-3-ylmethoxy)silane (PubChem CID 91700217) has the molecular formula C16H25NO2Si and a molecular weight of 291.47 g/mol. Its IUPAC name is 2-bicyclo[2.2.1]heptanylmethoxy-dimethyl-(pyridin-3-ylmethoxy)silane.
| Compound Name | 2-bicyclo[2.2.1]heptanylmethoxy-dimethyl-(pyridin-3-ylmethoxy)silane |
|---|---|
| PubChem CID | 91700217 |
| Molecular Formula | C16H25NO2Si |
| Molecular Weight | 291.47 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | 2-bicyclo[2.2.1]heptanylmethoxy-dimethyl-(pyridin-3-ylmethoxy)silane |
| SMILES | C[Si](C)(OCc1cccnc1)OCC1CC2CCC1C2 |
| InChI | InChI=1S/C16H25NO2Si/c1-20(2,18-11-14-4-3-7-17-10-14)19-12-16-9-13-5-6-15(16)8-13/h3-4,7,10,13,15-16H,5-6,8-9,11-12H2,1-2H3 |
| InChIKey | KZOIQGYPLSMEAT-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.47 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|