C20H39NO6Si2 — CID 91699999
2-[2-(2-butoxyethoxy)ethoxy]ethoxy-[dimethyl(pyridin-3-ylmethoxy)silyl]oxy-dimethylsilane (PubChem CID 91699999) has the molecular formula C20H39NO6Si2 and a molecular weight of 445.71 g/mol. Its IUPAC name is 2-[2-(2-butoxyethoxy)ethoxy]ethoxy-[dimethyl(pyridin-3-ylmethoxy)silyl]oxy-dimethylsilane.
| Compound Name | 2-[2-(2-butoxyethoxy)ethoxy]ethoxy-[dimethyl(pyridin-3-ylmethoxy)silyl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 91699999 |
| Molecular Formula | C20H39NO6Si2 |
| Molecular Weight | 445.71 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | 2-[2-(2-butoxyethoxy)ethoxy]ethoxy-[dimethyl(pyridin-3-ylmethoxy)silyl]oxy-dimethylsilane |
| SMILES | CCCCOCCOCCOCCO[Si](C)(C)O[Si](C)(C)OCc1cccnc1 |
| InChI | InChI=1S/C20H39NO6Si2/c1-6-7-11-22-12-13-23-14-15-24-16-17-25-28(2,3)27-29(4,5)26-19-20-9-8-10-21-18-20/h8-10,18H,6-7,11-17,19H2,1-5H3 |
| InChIKey | CGLZSBLWEYZKOS-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 68.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.71 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|