C18H35NO3Si2 — CID 91700248
[dimethyl(octan-2-yloxy)silyl]oxy-dimethyl-(pyridin-3-ylmethoxy)silane (PubChem CID 91700248) has the molecular formula C18H35NO3Si2 and a molecular weight of 369.65 g/mol. Its IUPAC name is [dimethyl(octan-2-yloxy)silyl]oxy-dimethyl-(pyridin-3-ylmethoxy)silane.
| Compound Name | [dimethyl(octan-2-yloxy)silyl]oxy-dimethyl-(pyridin-3-ylmethoxy)silane |
|---|---|
| PubChem CID | 91700248 |
| Molecular Formula | C18H35NO3Si2 |
| Molecular Weight | 369.65 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | [dimethyl(octan-2-yloxy)silyl]oxy-dimethyl-(pyridin-3-ylmethoxy)silane |
| SMILES | CCCCCCC(C)O[Si](C)(C)O[Si](C)(C)OCc1cccnc1 |
| InChI | InChI=1S/C18H35NO3Si2/c1-7-8-9-10-12-17(2)21-24(5,6)22-23(3,4)20-16-18-13-11-14-19-15-18/h11,13-15,17H,7-10,12,16H2,1-6H3 |
| InChIKey | PNAJSYDKGNRQFP-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.65 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|