C14H15FN4O3S — CID 136559065
N-cyclopropyl-5-[(3-fluorophenyl)sulfonylamino]-1-methylpyrazole-4-carboxamide (PubChem CID 136559065) has the molecular formula C14H15FN4O3S and a molecular weight of 338.36 g/mol. Its IUPAC name is N-cyclopropyl-5-[(3-fluorophenyl)sulfonylamino]-1-methylpyrazole-4-carboxamide.
| Compound Name | N-cyclopropyl-5-[(3-fluorophenyl)sulfonylamino]-1-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 136559065 |
| Molecular Formula | C14H15FN4O3S |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | N-cyclopropyl-5-[(3-fluorophenyl)sulfonylamino]-1-methylpyrazole-4-carboxamide |
| SMILES | Cn1ncc(C(=O)NC2CC2)c1NS(=O)(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C14H15FN4O3S/c1-19-13(12(8-16-19)14(20)17-10-5-6-10)18-23(21,22)11-4-2-3-9(15)7-11/h2-4,7-8,10,18H,5-6H2,1H3,(H,17,20) |
| InChIKey | NLSRNSCZYCWJDB-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |