About N-buta-2,3-dienyl-2-(4-cyclohexyl-1,3-thiazol-2-yl)acetamide
N-buta-2,3-dienyl-2-(4-cyclohexyl-1,3-thiazol-2-yl)acetamide (PubChem CID 136559607) has the molecular formula C15H20N2OS
and a molecular weight of 276.40 g/mol. Its IUPAC name is N-buta-2,3-dienyl-2-(4-cyclohexyl-1,3-thiazol-2-yl)acetamide.
Molecular Properties
| Compound Name | N-buta-2,3-dienyl-2-(4-cyclohexyl-1,3-thiazol-2-yl)acetamide |
| PubChem CID | 136559607 |
| Molecular Formula | C15H20N2OS |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | N-buta-2,3-dienyl-2-(4-cyclohexyl-1,3-thiazol-2-yl)acetamide |
| SMILES | C=C=CCNC(=O)Cc1nc(C2CCCCC2)cs1 |
| InChI | InChI=1S/C15H20N2OS/c1-2-3-9-16-14(18)10-15-17-13(11-19-15)12-7-5-4-6-8-12/h3,11-12H,1,4-10H2,(H,16,18) |
| InChIKey | DILDXHRRJDHSRZ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-buta-2,3-dienyl-2-(4-cyclohexyl-1,3-thiazol-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-buta-2,3-dienyl-2-(4-cyclohexyl-1,3-thiazol-2-yl)acetamide?
The IUPAC name of N-buta-2,3-dienyl-2-(4-cyclohexyl-1,3-thiazol-2-yl)acetamide (CID 136559607) is N-buta-2,3-dienyl-2-(4-cyclohexyl-1,3-thiazol-2-yl)acetamide.
What is the SMILES notation for N-buta-2,3-dienyl-2-(4-cyclohexyl-1,3-thiazol-2-yl)acetamide?
The canonical SMILES for N-buta-2,3-dienyl-2-(4-cyclohexyl-1,3-thiazol-2-yl)acetamide is C=C=CCNC(=O)Cc1nc(C2CCCCC2)cs1.
What is the InChIKey of N-buta-2,3-dienyl-2-(4-cyclohexyl-1,3-thiazol-2-yl)acetamide?
The InChIKey is DILDXHRRJDHSRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2OS/c1-2-3-9-16-14(18)10-15-17-13(11-19-15)12-7-5-4-6-8-12/h3,11-12H,1,4-10H2,(H,16,18).
What are the key properties of N-buta-2,3-dienyl-2-(4-cyclohexyl-1,3-thiazol-2-yl)acetamide?
N-buta-2,3-dienyl-2-(4-cyclohexyl-1,3-thiazol-2-yl)acetamide has a molecular weight of 276.40 g/mol, XLogP of 3.19, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-buta-2,3-dienyl-2-(4-cyclohexyl-1,3-thiazol-2-yl)acetamide is sourced from PubChem (CID 136559607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).