C15H20ClN3O3 — CID 136561634
2-chloro-N-(1-ethyl-4,4-dimethylpyrrolidin-3-yl)-4-nitrobenzamide (PubChem CID 136561634) has the molecular formula C15H20ClN3O3 and a molecular weight of 325.80 g/mol. Its IUPAC name is 2-chloro-N-(1-ethyl-4,4-dimethylpyrrolidin-3-yl)-4-nitrobenzamide.
| Compound Name | 2-chloro-N-(1-ethyl-4,4-dimethylpyrrolidin-3-yl)-4-nitrobenzamide |
|---|---|
| PubChem CID | 136561634 |
| Molecular Formula | C15H20ClN3O3 |
| Molecular Weight | 325.80 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 2-chloro-N-(1-ethyl-4,4-dimethylpyrrolidin-3-yl)-4-nitrobenzamide |
| SMILES | CCN1CC(NC(=O)c2ccc([N+](=O)[O-])cc2Cl)C(C)(C)C1 |
| InChI | InChI=1S/C15H20ClN3O3/c1-4-18-8-13(15(2,3)9-18)17-14(20)11-6-5-10(19(21)22)7-12(11)16/h5-7,13H,4,8-9H2,1-3H3,(H,17,20) |
| InChIKey | NGGDQGWVSIHNRS-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.80 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|