C15H19F3N2O4 — CID 136562269
tert-butyl N-[5-[(2-ethoxyacetyl)amino]-2,3,4-trifluorophenyl]carbamate (PubChem CID 136562269) has the molecular formula C15H19F3N2O4 and a molecular weight of 348.32 g/mol. Its IUPAC name is tert-butyl N-[5-[(2-ethoxyacetyl)amino]-2,3,4-trifluorophenyl]carbamate.
| Compound Name | tert-butyl N-[5-[(2-ethoxyacetyl)amino]-2,3,4-trifluorophenyl]carbamate |
|---|---|
| PubChem CID | 136562269 |
| Molecular Formula | C15H19F3N2O4 |
| Molecular Weight | 348.32 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | tert-butyl N-[5-[(2-ethoxyacetyl)amino]-2,3,4-trifluorophenyl]carbamate |
| SMILES | CCOCC(=O)Nc1cc(NC(=O)OC(C)(C)C)c(F)c(F)c1F |
| InChI | InChI=1S/C15H19F3N2O4/c1-5-23-7-10(21)19-8-6-9(12(17)13(18)11(8)16)20-14(22)24-15(2,3)4/h6H,5,7H2,1-4H3,(H,19,21)(H,20,22) |
| InChIKey | RXJFFCHWQSCTIG-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.32 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|