C20H26N2O3 — CID 136564104
N-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]-2-phenyloxolane-2-carboxamide (PubChem CID 136564104) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is N-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]-2-phenyloxolane-2-carboxamide.
| Compound Name | N-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]-2-phenyloxolane-2-carboxamide |
|---|---|
| PubChem CID | 136564104 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | N-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]-2-phenyloxolane-2-carboxamide |
| SMILES | CCC(CC)c1cc(CNC(=O)C2(c3ccccc3)CCCO2)on1 |
| InChI | InChI=1S/C20H26N2O3/c1-3-15(4-2)18-13-17(25-22-18)14-21-19(23)20(11-8-12-24-20)16-9-6-5-7-10-16/h5-7,9-10,13,15H,3-4,8,11-12,14H2,1-2H3,(H,21,23) |
| InChIKey | BCVZHEASAWZABL-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |