C15H21N3O3 — CID 136565417
4-methoxy-N-(4-methoxybutyl)-N-methylpyrazolo[1,5-a]pyridine-3-carboxamide (PubChem CID 136565417) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is 4-methoxy-N-(4-methoxybutyl)-N-methylpyrazolo[1,5-a]pyridine-3-carboxamide.
| Compound Name | 4-methoxy-N-(4-methoxybutyl)-N-methylpyrazolo[1,5-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 136565417 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 4-methoxy-N-(4-methoxybutyl)-N-methylpyrazolo[1,5-a]pyridine-3-carboxamide |
| SMILES | COCCCCN(C)C(=O)c1cnn2cccc(OC)c12 |
| InChI | InChI=1S/C15H21N3O3/c1-17(8-4-5-10-20-2)15(19)12-11-16-18-9-6-7-13(21-3)14(12)18/h6-7,9,11H,4-5,8,10H2,1-3H3 |
| InChIKey | DFRGPOHEOWXAIC-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|