C19H25N3O2 — CID 136566340
4-cyclohexyl-N-[2-hydroxy-2-(2-methylpyrazol-3-yl)ethyl]benzamide (PubChem CID 136566340) has the molecular formula C19H25N3O2 and a molecular weight of 327.43 g/mol. Its IUPAC name is 4-cyclohexyl-N-[2-hydroxy-2-(2-methylpyrazol-3-yl)ethyl]benzamide.
| Compound Name | 4-cyclohexyl-N-[2-hydroxy-2-(2-methylpyrazol-3-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 136566340 |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | 4-cyclohexyl-N-[2-hydroxy-2-(2-methylpyrazol-3-yl)ethyl]benzamide |
| SMILES | Cn1nccc1C(O)CNC(=O)c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C19H25N3O2/c1-22-17(11-12-21-22)18(23)13-20-19(24)16-9-7-15(8-10-16)14-5-3-2-4-6-14/h7-12,14,18,23H,2-6,13H2,1H3,(H,20,24) |
| InChIKey | SLGDZZWDGSHYFL-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |