C15H19N5O3 — CID 136568031
7-[2-(furan-3-yl)acetyl]-N,N,3-trimethyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-6-carboxamide (PubChem CID 136568031) has the molecular formula C15H19N5O3 and a molecular weight of 317.35 g/mol. Its IUPAC name is 7-[2-(furan-3-yl)acetyl]-N,N,3-trimethyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-6-carboxamide.
| Compound Name | 7-[2-(furan-3-yl)acetyl]-N,N,3-trimethyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-6-carboxamide |
|---|---|
| PubChem CID | 136568031 |
| Molecular Formula | C15H19N5O3 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | 7-[2-(furan-3-yl)acetyl]-N,N,3-trimethyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-6-carboxamide |
| SMILES | Cc1nnc2n1CC(C(=O)N(C)C)N(C(=O)Cc1ccoc1)C2 |
| InChI | InChI=1S/C15H19N5O3/c1-10-16-17-13-8-20(14(21)6-11-4-5-23-9-11)12(7-19(10)13)15(22)18(2)3/h4-5,9,12H,6-8H2,1-3H3 |
| InChIKey | PWFRQLVIYGPSPV-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 84.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |