C14H20N6OS — CID 136564565
N,N,3-trimethyl-7-[2-(1,3-thiazol-5-yl)ethyl]-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-6-carboxamide (PubChem CID 136564565) has the molecular formula C14H20N6OS and a molecular weight of 320.42 g/mol. Its IUPAC name is N,N,3-trimethyl-7-[2-(1,3-thiazol-5-yl)ethyl]-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-6-carboxamide.
| Compound Name | N,N,3-trimethyl-7-[2-(1,3-thiazol-5-yl)ethyl]-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-6-carboxamide |
|---|---|
| PubChem CID | 136564565 |
| Molecular Formula | C14H20N6OS |
| Molecular Weight | 320.42 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | N,N,3-trimethyl-7-[2-(1,3-thiazol-5-yl)ethyl]-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-6-carboxamide |
| SMILES | Cc1nnc2n1CC(C(=O)N(C)C)N(CCc1cncs1)C2 |
| InChI | InChI=1S/C14H20N6OS/c1-10-16-17-13-8-19(5-4-11-6-15-9-22-11)12(7-20(10)13)14(21)18(2)3/h6,9,12H,4-5,7-8H2,1-3H3 |
| InChIKey | UXYLZHAKVKSQNZ-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.42 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |