C14H25N5O3S — CID 167790286
7-(3,3-dimethylbutylsulfonyl)-N,3-dimethyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-6-carboxamide (PubChem CID 167790286) has the molecular formula C14H25N5O3S and a molecular weight of 343.45 g/mol. Its IUPAC name is 7-(3,3-dimethylbutylsulfonyl)-N,3-dimethyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-6-carboxamide.
| Compound Name | 7-(3,3-dimethylbutylsulfonyl)-N,3-dimethyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-6-carboxamide |
|---|---|
| PubChem CID | 167790286 |
| Molecular Formula | C14H25N5O3S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | 7-(3,3-dimethylbutylsulfonyl)-N,3-dimethyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-6-carboxamide |
| SMILES | CNC(=O)C1Cn2c(C)nnc2CN1S(=O)(=O)CCC(C)(C)C |
| InChI | InChI=1S/C14H25N5O3S/c1-10-16-17-12-9-19(11(8-18(10)12)13(20)15-5)23(21,22)7-6-14(2,3)4/h11H,6-9H2,1-5H3,(H,15,20) |
| InChIKey | NJNSTVCXCHTIDH-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |