C14H19N3O4S — CID 136571184
ethyl 4-[(2-methyl-4,5,6,7-tetrahydroindazol-3-yl)sulfonylamino]but-2-ynoate (PubChem CID 136571184) has the molecular formula C14H19N3O4S and a molecular weight of 325.39 g/mol. Its IUPAC name is ethyl 4-[(2-methyl-4,5,6,7-tetrahydroindazol-3-yl)sulfonylamino]but-2-ynoate.
| Compound Name | ethyl 4-[(2-methyl-4,5,6,7-tetrahydroindazol-3-yl)sulfonylamino]but-2-ynoate |
|---|---|
| PubChem CID | 136571184 |
| Molecular Formula | C14H19N3O4S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | ethyl 4-[(2-methyl-4,5,6,7-tetrahydroindazol-3-yl)sulfonylamino]but-2-ynoate |
| SMILES | CCOC(=O)C#CCNS(=O)(=O)c1c2c(nn1C)CCCC2 |
| InChI | InChI=1S/C14H19N3O4S/c1-3-21-13(18)9-6-10-15-22(19,20)14-11-7-4-5-8-12(11)16-17(14)2/h15H,3-5,7-8,10H2,1-2H3 |
| InChIKey | AQDCOHDZIHCIGD-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|