C16H30N2O5 — CID 136571931
diethyl 2-[3-[methyl-[2-oxo-2-(propan-2-ylamino)ethyl]amino]propyl]propanedioate (PubChem CID 136571931) has the molecular formula C16H30N2O5 and a molecular weight of 330.43 g/mol. Its IUPAC name is diethyl 2-[3-[methyl-[2-oxo-2-(propan-2-ylamino)ethyl]amino]propyl]propanedioate.
| Compound Name | diethyl 2-[3-[methyl-[2-oxo-2-(propan-2-ylamino)ethyl]amino]propyl]propanedioate |
|---|---|
| PubChem CID | 136571931 |
| Molecular Formula | C16H30N2O5 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | diethyl 2-[3-[methyl-[2-oxo-2-(propan-2-ylamino)ethyl]amino]propyl]propanedioate |
| SMILES | CCOC(=O)C(CCCN(C)CC(=O)NC(C)C)C(=O)OCC |
| InChI | InChI=1S/C16H30N2O5/c1-6-22-15(20)13(16(21)23-7-2)9-8-10-18(5)11-14(19)17-12(3)4/h12-13H,6-11H2,1-5H3,(H,17,19) |
| InChIKey | GRAWIIVGQFOYEU-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|