C14H21N3O4S — CID 136572010
5-[1-(cyclohexylmethylsulfonyl)azetidin-3-yl]-1H-pyrazole-3-carboxylic acid (PubChem CID 136572010) has the molecular formula C14H21N3O4S and a molecular weight of 327.41 g/mol. Its IUPAC name is 5-[1-(cyclohexylmethylsulfonyl)azetidin-3-yl]-1H-pyrazole-3-carboxylic acid.
| Compound Name | 5-[1-(cyclohexylmethylsulfonyl)azetidin-3-yl]-1H-pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 136572010 |
| Molecular Formula | C14H21N3O4S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 5-[1-(cyclohexylmethylsulfonyl)azetidin-3-yl]-1H-pyrazole-3-carboxylic acid |
| SMILES | O=C(O)c1cc(C2CN(S(=O)(=O)CC3CCCCC3)C2)[nH]n1 |
| InChI | InChI=1S/C14H21N3O4S/c18-14(19)13-6-12(15-16-13)11-7-17(8-11)22(20,21)9-10-4-2-1-3-5-10/h6,10-11H,1-5,7-9H2,(H,15,16)(H,18,19) |
| InChIKey | NZBZRRXJWVOFOP-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 103.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |