C19H17N3O2 — CID 136574503
3-[4-(4-methyl-1,3-benzoxazol-2-yl)morpholin-2-yl]benzonitrile (PubChem CID 136574503) has the molecular formula C19H17N3O2 and a molecular weight of 319.36 g/mol. Its IUPAC name is 3-[4-(4-methyl-1,3-benzoxazol-2-yl)morpholin-2-yl]benzonitrile.
| Compound Name | 3-[4-(4-methyl-1,3-benzoxazol-2-yl)morpholin-2-yl]benzonitrile |
|---|---|
| PubChem CID | 136574503 |
| Molecular Formula | C19H17N3O2 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | 3-[4-(4-methyl-1,3-benzoxazol-2-yl)morpholin-2-yl]benzonitrile |
| SMILES | Cc1cccc2oc(N3CCOC(c4cccc(C#N)c4)C3)nc12 |
| InChI | InChI=1S/C19H17N3O2/c1-13-4-2-7-16-18(13)21-19(24-16)22-8-9-23-17(12-22)15-6-3-5-14(10-15)11-20/h2-7,10,17H,8-9,12H2,1H3 |
| InChIKey | QRKZXTXTQKPPCR-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 62.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |