C18H21ClN2O2 — CID 136582569
(4aR,7aS)-1-[(1R,2R)-2-(3-chlorophenyl)cyclopropanecarbonyl]-6-methyl-2,3,4,4a,7,7a-hexahydropyrrolo[3,4-b]pyridin-5-one (PubChem CID 136582569) has the molecular formula C18H21ClN2O2 and a molecular weight of 332.83 g/mol. Its IUPAC name is (4aR,7aS)-1-[(1R,2R)-2-(3-chlorophenyl)cyclopropanecarbonyl]-6-methyl-2,3,4,4a,7,7a-hexahydropyrrolo[3,4-b]pyridin-5-one.
| Compound Name | (4aR,7aS)-1-[(1R,2R)-2-(3-chlorophenyl)cyclopropanecarbonyl]-6-methyl-2,3,4,4a,7,7a-hexahydropyrrolo[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 136582569 |
| Molecular Formula | C18H21ClN2O2 |
| Molecular Weight | 332.83 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | (4aR,7aS)-1-[(1R,2R)-2-(3-chlorophenyl)cyclopropanecarbonyl]-6-methyl-2,3,4,4a,7,7a-hexahydropyrrolo[3,4-b]pyridin-5-one |
| SMILES | CN1C[C@@H]2[C@@H](CCCN2C(=O)[C@@H]2C[C@H]2c2cccc(Cl)c2)C1=O |
| InChI | InChI=1S/C18H21ClN2O2/c1-20-10-16-13(17(20)22)6-3-7-21(16)18(23)15-9-14(15)11-4-2-5-12(19)8-11/h2,4-5,8,13-16H,3,6-7,9-10H2,1H3/t13-,14+,15-,16-/m1/s1 |
| InChIKey | AIAGHWAQOQQAID-QKPAOTATSA-N |
| XLogP | 2.52 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.83 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |