C15H25ClN2O2 — CID 136583336
1-[[(1R)-1-(2-chlorophenyl)ethyl]amino]-3-[2-methoxyethyl(methyl)amino]propan-2-ol (PubChem CID 136583336) has the molecular formula C15H25ClN2O2 and a molecular weight of 300.83 g/mol. Its IUPAC name is 1-[[(1R)-1-(2-chlorophenyl)ethyl]amino]-3-[2-methoxyethyl(methyl)amino]propan-2-ol.
| Compound Name | 1-[[(1R)-1-(2-chlorophenyl)ethyl]amino]-3-[2-methoxyethyl(methyl)amino]propan-2-ol |
|---|---|
| PubChem CID | 136583336 |
| Molecular Formula | C15H25ClN2O2 |
| Molecular Weight | 300.83 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 1-[[(1R)-1-(2-chlorophenyl)ethyl]amino]-3-[2-methoxyethyl(methyl)amino]propan-2-ol |
| SMILES | COCCN(C)CC(O)CN[C@H](C)c1ccccc1Cl |
| InChI | InChI=1S/C15H25ClN2O2/c1-12(14-6-4-5-7-15(14)16)17-10-13(19)11-18(2)8-9-20-3/h4-7,12-13,17,19H,8-11H2,1-3H3/t12-,13?/m1/s1 |
| InChIKey | GRPSZQIPKMWBGI-PZORYLMUSA-N |
| XLogP | 1.93 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.83 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |