About 2-[2-[[(1R,2S)-2-ethoxy-2-methylcyclopropyl]carbamoyl]phenyl]benzoic acid
2-[2-[[(1R,2S)-2-ethoxy-2-methylcyclopropyl]carbamoyl]phenyl]benzoic acid (PubChem CID 136584706) has the molecular formula C20H21NO4
and a molecular weight of 339.39 g/mol. Its IUPAC name is 2-[2-[[(1R,2S)-2-ethoxy-2-methylcyclopropyl]carbamoyl]phenyl]benzoic acid.
Molecular Properties
| Compound Name | 2-[2-[[(1R,2S)-2-ethoxy-2-methylcyclopropyl]carbamoyl]phenyl]benzoic acid |
| PubChem CID | 136584706 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 2-[2-[[(1R,2S)-2-ethoxy-2-methylcyclopropyl]carbamoyl]phenyl]benzoic acid |
| SMILES | CCO[C@@]1(C)C[C@H]1NC(=O)c1ccccc1-c1ccccc1C(=O)O |
| InChI | InChI=1S/C20H21NO4/c1-3-25-20(2)12-17(20)21-18(22)15-10-6-4-8-13(15)14-9-5-7-11-16(14)19(23)24/h4-11,17H,3,12H2,1-2H3,(H,21,22)(H,23,24)/t17-,20+/m1/s1 |
| InChIKey | DSRNEYAKZNQCBS-XLIONFOSSA-N |
| XLogP | 3.35 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[2-[[(1R,2S)-2-ethoxy-2-methylcyclopropyl]carbamoyl]phenyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[[(1R,2S)-2-ethoxy-2-methylcyclopropyl]carbamoyl]phenyl]benzoic acid?
The IUPAC name of 2-[2-[[(1R,2S)-2-ethoxy-2-methylcyclopropyl]carbamoyl]phenyl]benzoic acid (CID 136584706) is 2-[2-[[(1R,2S)-2-ethoxy-2-methylcyclopropyl]carbamoyl]phenyl]benzoic acid.
What is the SMILES notation for 2-[2-[[(1R,2S)-2-ethoxy-2-methylcyclopropyl]carbamoyl]phenyl]benzoic acid?
The canonical SMILES for 2-[2-[[(1R,2S)-2-ethoxy-2-methylcyclopropyl]carbamoyl]phenyl]benzoic acid is CCO[C@@]1(C)C[C@H]1NC(=O)c1ccccc1-c1ccccc1C(=O)O.
What is the InChIKey of 2-[2-[[(1R,2S)-2-ethoxy-2-methylcyclopropyl]carbamoyl]phenyl]benzoic acid?
The InChIKey is DSRNEYAKZNQCBS-XLIONFOSSA-N. The full InChI is InChI=1S/C20H21NO4/c1-3-25-20(2)12-17(20)21-18(22)15-10-6-4-8-13(15)14-9-5-7-11-16(14)19(23)24/h4-11,17H,3,12H2,1-2H3,(H,21,22)(H,23,24)/t17-,20+/m1/s1.
What are the key properties of 2-[2-[[(1R,2S)-2-ethoxy-2-methylcyclopropyl]carbamoyl]phenyl]benzoic acid?
2-[2-[[(1R,2S)-2-ethoxy-2-methylcyclopropyl]carbamoyl]phenyl]benzoic acid has a molecular weight of 339.39 g/mol, XLogP of 3.35, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[[(1R,2S)-2-ethoxy-2-methylcyclopropyl]carbamoyl]phenyl]benzoic acid is sourced from PubChem (CID 136584706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).