C9H12BrNO4S2 — CID 136584791
(2R)-2-[(4-bromothiophen-3-yl)sulfonylamino]-3-methylbutanoic acid (PubChem CID 136584791) has the molecular formula C9H12BrNO4S2 and a molecular weight of 342.24 g/mol. Its IUPAC name is (2R)-2-[(4-bromothiophen-3-yl)sulfonylamino]-3-methylbutanoic acid.
| Compound Name | (2R)-2-[(4-bromothiophen-3-yl)sulfonylamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 136584791 |
| Molecular Formula | C9H12BrNO4S2 |
| Molecular Weight | 342.24 g/mol |
| Exact Mass | 340.94 |
| IUPAC Name | (2R)-2-[(4-bromothiophen-3-yl)sulfonylamino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@@H](NS(=O)(=O)c1cscc1Br)C(=O)O |
| InChI | InChI=1S/C9H12BrNO4S2/c1-5(2)8(9(12)13)11-17(14,15)7-4-16-3-6(7)10/h3-5,8,11H,1-2H3,(H,12,13)/t8-/m1/s1 |
| InChIKey | UALJJKJADBBVDJ-MRVPVSSYSA-N |
| XLogP | 1.90 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.24 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |