C13H18F3N5O — CID 136585572
(3aR,6aS)-2-methyl-N-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxamide (PubChem CID 136585572) has the molecular formula C13H18F3N5O and a molecular weight of 317.32 g/mol. Its IUPAC name is (3aR,6aS)-2-methyl-N-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxamide.
| Compound Name | (3aR,6aS)-2-methyl-N-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 136585572 |
| Molecular Formula | C13H18F3N5O |
| Molecular Weight | 317.32 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | (3aR,6aS)-2-methyl-N-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxamide |
| SMILES | CN1C[C@@H]2CN(C(=O)Nc3ccn(CC(F)(F)F)n3)C[C@@H]2C1 |
| InChI | InChI=1S/C13H18F3N5O/c1-19-4-9-6-20(7-10(9)5-19)12(22)17-11-2-3-21(18-11)8-13(14,15)16/h2-3,9-10H,4-8H2,1H3,(H,17,18,22)/t9-,10+ |
| InChIKey | CGWLCTUHWXWHGZ-AOOOYVTPSA-N |
| XLogP | 1.47 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.32 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |