C16H21F3N4O2 — CID 154848780
(3aR,6aS)-N-[3-cyclopropyl-1-(2,2,2-trifluoroethyl)pyrazol-4-yl]-5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxamide (PubChem CID 154848780) has the molecular formula C16H21F3N4O2 and a molecular weight of 358.36 g/mol. Its IUPAC name is (3aR,6aS)-N-[3-cyclopropyl-1-(2,2,2-trifluoroethyl)pyrazol-4-yl]-5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxamide.
| Compound Name | (3aR,6aS)-N-[3-cyclopropyl-1-(2,2,2-trifluoroethyl)pyrazol-4-yl]-5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 154848780 |
| Molecular Formula | C16H21F3N4O2 |
| Molecular Weight | 358.36 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | (3aR,6aS)-N-[3-cyclopropyl-1-(2,2,2-trifluoroethyl)pyrazol-4-yl]-5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxamide |
| SMILES | O=C(Nc1cn(CC(F)(F)F)nc1C1CC1)N1C[C@H]2CC(O)C[C@H]2C1 |
| InChI | InChI=1S/C16H21F3N4O2/c17-16(18,19)8-23-7-13(14(21-23)9-1-2-9)20-15(25)22-5-10-3-12(24)4-11(10)6-22/h7,9-12,24H,1-6,8H2,(H,20,25)/t10-,11+,12? |
| InChIKey | KRHQODCWMBESLH-FOSCPWQOSA-N |
| XLogP | 2.56 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.36 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |