C15H19ClN2O3S — CID 136585646
(3aS,6aR)-N-(6-chloro-2,3-dimethylphenyl)-2,2-dioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-c]pyrrole-5-carboxamide (PubChem CID 136585646) has the molecular formula C15H19ClN2O3S and a molecular weight of 342.85 g/mol. Its IUPAC name is (3aS,6aR)-N-(6-chloro-2,3-dimethylphenyl)-2,2-dioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-c]pyrrole-5-carboxamide.
| Compound Name | (3aS,6aR)-N-(6-chloro-2,3-dimethylphenyl)-2,2-dioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-c]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 136585646 |
| Molecular Formula | C15H19ClN2O3S |
| Molecular Weight | 342.85 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | (3aS,6aR)-N-(6-chloro-2,3-dimethylphenyl)-2,2-dioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-c]pyrrole-5-carboxamide |
| SMILES | Cc1ccc(Cl)c(NC(=O)N2C[C@@H]3CS(=O)(=O)C[C@@H]3C2)c1C |
| InChI | InChI=1S/C15H19ClN2O3S/c1-9-3-4-13(16)14(10(9)2)17-15(19)18-5-11-7-22(20,21)8-12(11)6-18/h3-4,11-12H,5-8H2,1-2H3,(H,17,19)/t11-,12+ |
| InChIKey | LPRUCKUZHJTPGI-TXEJJXNPSA-N |
| XLogP | 2.47 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.85 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |