C18H21N3O2 — CID 136586977
(3R)-3-ethyl-4-(2-isoquinolin-6-ylacetyl)-1,4-diazepan-2-one (PubChem CID 136586977) has the molecular formula C18H21N3O2 and a molecular weight of 311.38 g/mol. Its IUPAC name is (3R)-3-ethyl-4-(2-isoquinolin-6-ylacetyl)-1,4-diazepan-2-one.
| Compound Name | (3R)-3-ethyl-4-(2-isoquinolin-6-ylacetyl)-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 136586977 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | (3R)-3-ethyl-4-(2-isoquinolin-6-ylacetyl)-1,4-diazepan-2-one |
| SMILES | CC[C@@H]1C(=O)NCCCN1C(=O)Cc1ccc2cnccc2c1 |
| InChI | InChI=1S/C18H21N3O2/c1-2-16-18(23)20-7-3-9-21(16)17(22)11-13-4-5-15-12-19-8-6-14(15)10-13/h4-6,8,10,12,16H,2-3,7,9,11H2,1H3,(H,20,23)/t16-/m1/s1 |
| InChIKey | BUHRAPIPTZCZTH-MRXNPFEDSA-N |
| XLogP | 1.90 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |