C18H25N3 — CID 58080818
6-[[(2R)-2-methyl-1,4-diazonan-1-yl]methyl]isoquinoline (PubChem CID 58080818) has the molecular formula C18H25N3 and a molecular weight of 283.42 g/mol. Its IUPAC name is 6-[[(2R)-2-methyl-1,4-diazonan-1-yl]methyl]isoquinoline.
| Compound Name | 6-[[(2R)-2-methyl-1,4-diazonan-1-yl]methyl]isoquinoline |
|---|---|
| PubChem CID | 58080818 |
| Molecular Formula | C18H25N3 |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.20 |
| IUPAC Name | 6-[[(2R)-2-methyl-1,4-diazonan-1-yl]methyl]isoquinoline |
| SMILES | C[C@@H]1CNCCCCCN1Cc1ccc2cnccc2c1 |
| InChI | InChI=1S/C18H25N3/c1-15-12-19-8-3-2-4-10-21(15)14-16-5-6-18-13-20-9-7-17(18)11-16/h5-7,9,11,13,15,19H,2-4,8,10,12,14H2,1H3/t15-/m1/s1 |
| InChIKey | ZWJPVNOXUIQWGF-OAHLLOKOSA-N |
| XLogP | 3.20 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |