C18H27N3 — CID 158799740
6-[[(2R,7R)-2,7-dimethyl-1,4-diazepan-1-yl]methyl]isoquinoline;methane (PubChem CID 158799740) has the molecular formula C18H27N3 and a molecular weight of 285.44 g/mol. Its IUPAC name is 6-[[(2R,7R)-2,7-dimethyl-1,4-diazepan-1-yl]methyl]isoquinoline;methane.
| Compound Name | 6-[[(2R,7R)-2,7-dimethyl-1,4-diazepan-1-yl]methyl]isoquinoline;methane |
|---|---|
| PubChem CID | 158799740 |
| Molecular Formula | C18H27N3 |
| Molecular Weight | 285.44 g/mol |
| Exact Mass | 285.22 |
| IUPAC Name | 6-[[(2R,7R)-2,7-dimethyl-1,4-diazepan-1-yl]methyl]isoquinoline;methane |
| SMILES | C.C[C@@H]1CCNC[C@@H](C)N1Cc1ccc2cnccc2c1 |
| InChI | InChI=1S/C17H23N3.CH4/c1-13-5-7-18-10-14(2)20(13)12-15-3-4-17-11-19-8-6-16(17)9-15;/h3-4,6,8-9,11,13-14,18H,5,7,10,12H2,1-2H3;1H4/t13-,14-;/m1./s1 |
| InChIKey | ITIFWRGFEOOZPK-DTPOWOMPSA-N |
| XLogP | 3.44 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.44 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |