C16H17N5O — CID 136588824
2-[[4-(6-oxo-1H-pyrimidin-2-yl)cyclohexyl]amino]pyridine-3-carbonitrile (PubChem CID 136588824) has the molecular formula C16H17N5O and a molecular weight of 295.35 g/mol. Its IUPAC name is 2-[[4-(6-oxo-1H-pyrimidin-2-yl)cyclohexyl]amino]pyridine-3-carbonitrile.
| Compound Name | 2-[[4-(6-oxo-1H-pyrimidin-2-yl)cyclohexyl]amino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 136588824 |
| Molecular Formula | C16H17N5O |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 2-[[4-(6-oxo-1H-pyrimidin-2-yl)cyclohexyl]amino]pyridine-3-carbonitrile |
| SMILES | N#Cc1cccnc1NC1CCC(c2nccc(=O)[nH]2)CC1 |
| InChI | InChI=1S/C16H17N5O/c17-10-12-2-1-8-18-16(12)20-13-5-3-11(4-6-13)15-19-9-7-14(22)21-15/h1-2,7-9,11,13H,3-6H2,(H,18,20)(H,19,21,22) |
| InChIKey | ICCLKOUZAPZJMF-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 94.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |