C17H23FN4O2 — CID 136589026
(Z)-3-cyclopropyl-2-fluoro-N-[(3S,4S)-3-[(2-methylpyrimidin-4-yl)amino]oxan-4-yl]but-2-enamide (PubChem CID 136589026) has the molecular formula C17H23FN4O2 and a molecular weight of 334.40 g/mol. Its IUPAC name is (Z)-3-cyclopropyl-2-fluoro-N-[(3S,4S)-3-[(2-methylpyrimidin-4-yl)amino]oxan-4-yl]but-2-enamide.
| Compound Name | (Z)-3-cyclopropyl-2-fluoro-N-[(3S,4S)-3-[(2-methylpyrimidin-4-yl)amino]oxan-4-yl]but-2-enamide |
|---|---|
| PubChem CID | 136589026 |
| Molecular Formula | C17H23FN4O2 |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | (Z)-3-cyclopropyl-2-fluoro-N-[(3S,4S)-3-[(2-methylpyrimidin-4-yl)amino]oxan-4-yl]but-2-enamide |
| SMILES | C/C(=C(/F)C(=O)N[C@H]1CCOC[C@H]1Nc1ccnc(C)n1)C1CC1 |
| InChI | InChI=1S/C17H23FN4O2/c1-10(12-3-4-12)16(18)17(23)22-13-6-8-24-9-14(13)21-15-5-7-19-11(2)20-15/h5,7,12-14H,3-4,6,8-9H2,1-2H3,(H,22,23)(H,19,20,21)/b16-10-/t13-,14+/m0/s1 |
| InChIKey | LAPTXKOILDMENY-IYFMVNHVSA-N |
| XLogP | 2.12 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|