About cis-(1R,2R)-2-(fluoromethyl)cyclopropan-1-amine
cis-(1R,2R)-2-(fluoromethyl)cyclopropan-1-amine (PubChem CID 136589400) has the molecular formula C4H8FN
and a molecular weight of 89.11 g/mol. Its IUPAC name is cis-(1R,2R)-2-(fluoromethyl)cyclopropan-1-amine.
Analyze cis-(1R,2R)-2-(fluoromethyl)cyclopropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1R,2R)-2-(fluoromethyl)cyclopropan-1-amine?
The IUPAC name of cis-(1R,2R)-2-(fluoromethyl)cyclopropan-1-amine (CID 136589400) is cis-(1R,2R)-2-(fluoromethyl)cyclopropan-1-amine.
What is the SMILES notation for cis-(1R,2R)-2-(fluoromethyl)cyclopropan-1-amine?
The canonical SMILES for cis-(1R,2R)-2-(fluoromethyl)cyclopropan-1-amine is N[C@@H]1C[C@H]1CF.
What is the InChIKey of cis-(1R,2R)-2-(fluoromethyl)cyclopropan-1-amine?
The InChIKey is PIOKPDRPYVKYRL-IUYQGCFVSA-N. The full InChI is InChI=1S/C4H8FN/c5-2-3-1-4(3)6/h3-4H,1-2,6H2/t3-,4+/m0/s1.
What are the key properties of cis-(1R,2R)-2-(fluoromethyl)cyclopropan-1-amine?
cis-(1R,2R)-2-(fluoromethyl)cyclopropan-1-amine has a molecular weight of 89.11 g/mol, XLogP of 0.30, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1R,2R)-2-(fluoromethyl)cyclopropan-1-amine is sourced from PubChem (CID 136589400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).