C15H15N3O2S — CID 136591908
[[2-hydroxy-5-[3-(hydroxymethyl)phenyl]phenyl]methylideneamino]thiourea (PubChem CID 136591908) has the molecular formula C15H15N3O2S and a molecular weight of 301.37 g/mol. Its IUPAC name is [[2-hydroxy-5-[3-(hydroxymethyl)phenyl]phenyl]methylideneamino]thiourea.
| Compound Name | [[2-hydroxy-5-[3-(hydroxymethyl)phenyl]phenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 136591908 |
| Molecular Formula | C15H15N3O2S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | [[2-hydroxy-5-[3-(hydroxymethyl)phenyl]phenyl]methylideneamino]thiourea |
| SMILES | NC(=S)NN=Cc1cc(-c2cccc(CO)c2)ccc1O |
| InChI | InChI=1S/C15H15N3O2S/c16-15(21)18-17-8-13-7-12(4-5-14(13)20)11-3-1-2-10(6-11)9-19/h1-8,19-20H,9H2,(H3,16,18,21) |
| InChIKey | MUWCZOZFIXRNDB-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|