C13H17N3O3S — CID 168535840
tert-butyl 3-[(carbamothioylhydrazinylidene)methyl]-4-hydroxybenzoate (PubChem CID 168535840) has the molecular formula C13H17N3O3S and a molecular weight of 295.36 g/mol. Its IUPAC name is tert-butyl 3-[(carbamothioylhydrazinylidene)methyl]-4-hydroxybenzoate.
| Compound Name | tert-butyl 3-[(carbamothioylhydrazinylidene)methyl]-4-hydroxybenzoate |
|---|---|
| PubChem CID | 168535840 |
| Molecular Formula | C13H17N3O3S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | tert-butyl 3-[(carbamothioylhydrazinylidene)methyl]-4-hydroxybenzoate |
| SMILES | CC(C)(C)OC(=O)c1ccc(O)c(C=NNC(N)=S)c1 |
| InChI | InChI=1S/C13H17N3O3S/c1-13(2,3)19-11(18)8-4-5-10(17)9(6-8)7-15-16-12(14)20/h4-7,17H,1-3H3,(H3,14,16,20) |
| InChIKey | PYDCHVDHVJHUCU-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 96.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|