C14H12ClN5OS — CID 135990550
[[5-[(4-chlorophenyl)diazenyl]-2-hydroxyphenyl]methylideneamino]thiourea (PubChem CID 135990550) has the molecular formula C14H12ClN5OS and a molecular weight of 333.80 g/mol. Its IUPAC name is [[5-[(4-chlorophenyl)diazenyl]-2-hydroxyphenyl]methylideneamino]thiourea.
| Compound Name | [[5-[(4-chlorophenyl)diazenyl]-2-hydroxyphenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 135990550 |
| Molecular Formula | C14H12ClN5OS |
| Molecular Weight | 333.80 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | [[5-[(4-chlorophenyl)diazenyl]-2-hydroxyphenyl]methylideneamino]thiourea |
| SMILES | NC(=S)NN=Cc1cc(/N=N/c2ccc(Cl)cc2)ccc1O |
| InChI | InChI=1S/C14H12ClN5OS/c15-10-1-3-11(4-2-10)18-19-12-5-6-13(21)9(7-12)8-17-20-14(16)22/h1-8,21H,(H3,16,20,22)/b17-8?,19-18+ |
| InChIKey | LNQDFTPAHRCXIL-BGKSAIBFSA-N |
| XLogP | 3.63 |
| TPSA | 95.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.80 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|