C42H55N3O2 — CID 136591935
2-[[(6E)-2-[(E)-2-(1-butyl-3,3-dimethyl-5-methylideneindol-1-ium-2-id-2-yl)ethenyl]-6-[(2Z)-2-(1-butyl-3,3,5-trimethylindol-2-ylidene)ethylidene]cyclohexylidene]amino]acetic acid (PubChem CID 136591935) has the molecular formula C42H55N3O2 and a molecular weight of 633.92 g/mol. Its IUPAC name is 2-[[(6E)-2-[(E)-2-(1-butyl-3,3-dimethyl-5-methylideneindol-1-ium-2-id-2-yl)ethenyl]-6-[(2Z)-2-(1-butyl-3,3,5-trimethylindol-2-ylidene)ethylidene]cyclohexylidene]amino]acetic acid.
| Compound Name | 2-[[(6E)-2-[(E)-2-(1-butyl-3,3-dimethyl-5-methylideneindol-1-ium-2-id-2-yl)ethenyl]-6-[(2Z)-2-(1-butyl-3,3,5-trimethylindol-2-ylidene)ethylidene]cyclohexylidene]amino]acetic acid |
|---|---|
| PubChem CID | 136591935 |
| Molecular Formula | C42H55N3O2 |
| Molecular Weight | 633.92 g/mol |
| Exact Mass | 633.43 |
| IUPAC Name | 2-[[(6E)-2-[(E)-2-(1-butyl-3,3-dimethyl-5-methylideneindol-1-ium-2-id-2-yl)ethenyl]-6-[(2Z)-2-(1-butyl-3,3,5-trimethylindol-2-ylidene)ethylidene]cyclohexylidene]amino]acetic acid |
| SMILES | C=c1ccc2c(c1)C(C)(C)[C-](/C=C/C1CCCC(=C\C=C3/N(CCCC)c4ccc(C)cc4C3(C)C)/C1=N\CC(=O)O)[N+]=2CCCC |
| InChI | InChI=1S/C42H55N3O2/c1-9-11-24-44-35-20-16-29(3)26-33(35)41(5,6)37(44)22-18-31-14-13-15-32(40(31)43-28-39(46)47)19-23-38-42(7,8)34-27-30(4)17-21-36(34)45(38)25-12-10-2/h16-23,26-27,31H,3,9-15,24-25,28H2,1-2,4-8H3,(H,46,47)/b22-18+,32-19+,38-23-,43-40- |
| InChIKey | LVJUQTYHEDEKMU-VPAOKKTPSA-N |
| XLogP | 7.81 |
| TPSA | 55.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.92 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|