C18H16N6OS — CID 136592012
4-[3-[(5-amino-1,3-benzothiazol-2-yl)methylamino]-1,2,4-triazin-5-yl]-3-methylphenol (PubChem CID 136592012) has the molecular formula C18H16N6OS and a molecular weight of 364.43 g/mol. Its IUPAC name is 4-[3-[(5-amino-1,3-benzothiazol-2-yl)methylamino]-1,2,4-triazin-5-yl]-3-methylphenol.
| Compound Name | 4-[3-[(5-amino-1,3-benzothiazol-2-yl)methylamino]-1,2,4-triazin-5-yl]-3-methylphenol |
|---|---|
| PubChem CID | 136592012 |
| Molecular Formula | C18H16N6OS |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 4-[3-[(5-amino-1,3-benzothiazol-2-yl)methylamino]-1,2,4-triazin-5-yl]-3-methylphenol |
| SMILES | Cc1cc(O)ccc1-c1cnnc(NCc2nc3cc(N)ccc3s2)n1 |
| InChI | InChI=1S/C18H16N6OS/c1-10-6-12(25)3-4-13(10)15-8-21-24-18(23-15)20-9-17-22-14-7-11(19)2-5-16(14)26-17/h2-8,25H,9,19H2,1H3,(H,20,23,24) |
| InChIKey | PEJQXUYCXYVHMD-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 109.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|