C31H39N7O5S — CID 71584039
tert-butyl N-[3,5-dimethyl-4-[3-[[5-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]-1,3-benzothiazol-2-yl]methylamino]-1,2,4-triazin-5-yl]phenyl]carbamate (PubChem CID 71584039) has the molecular formula C31H39N7O5S and a molecular weight of 621.76 g/mol. Its IUPAC name is tert-butyl N-[3,5-dimethyl-4-[3-[[5-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]-1,3-benzothiazol-2-yl]methylamino]-1,2,4-triazin-5-yl]phenyl]carbamate.
| Compound Name | tert-butyl N-[3,5-dimethyl-4-[3-[[5-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]-1,3-benzothiazol-2-yl]methylamino]-1,2,4-triazin-5-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 71584039 |
| Molecular Formula | C31H39N7O5S |
| Molecular Weight | 621.76 g/mol |
| Exact Mass | 621.27 |
| IUPAC Name | tert-butyl N-[3,5-dimethyl-4-[3-[[5-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]-1,3-benzothiazol-2-yl]methylamino]-1,2,4-triazin-5-yl]phenyl]carbamate |
| SMILES | Cc1cc(NC(=O)OC(C)(C)C)cc(C)c1-c1cnnc(NCc2nc3cc(OCCNC(=O)OC(C)(C)C)ccc3s2)n1 |
| InChI | InChI=1S/C31H39N7O5S/c1-18-13-20(35-29(40)43-31(6,7)8)14-19(2)26(18)23-16-34-38-27(37-23)33-17-25-36-22-15-21(9-10-24(22)44-25)41-12-11-32-28(39)42-30(3,4)5/h9-10,13-16H,11-12,17H2,1-8H3,(H,32,39)(H,35,40)(H,33,37,38) |
| InChIKey | QXFVXUAOPCFHFX-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 149.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.76 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|