C13H16N2O6 — CID 136592205
ethyl (Z)-2-hydroxy-3-(2-methoxy-5,6-dimethyl-3-nitro-4-pyridinyl)prop-2-enoate (PubChem CID 136592205) has the molecular formula C13H16N2O6 and a molecular weight of 296.28 g/mol. Its IUPAC name is ethyl (Z)-2-hydroxy-3-(2-methoxy-5,6-dimethyl-3-nitro-4-pyridinyl)prop-2-enoate.
| Compound Name | ethyl (Z)-2-hydroxy-3-(2-methoxy-5,6-dimethyl-3-nitro-4-pyridinyl)prop-2-enoate |
|---|---|
| PubChem CID | 136592205 |
| Molecular Formula | C13H16N2O6 |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | ethyl (Z)-2-hydroxy-3-(2-methoxy-5,6-dimethyl-3-nitro-4-pyridinyl)prop-2-enoate |
| SMILES | CCOC(=O)/C(O)=C/c1c(C)c(C)nc(OC)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H16N2O6/c1-5-21-13(17)10(16)6-9-7(2)8(3)14-12(20-4)11(9)15(18)19/h6,16H,5H2,1-4H3/b10-6- |
| InChIKey | VACLHBVZSVXZIQ-POHAHGRESA-N |
| XLogP | 2.08 |
| TPSA | 111.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|