C21H25BN5O3 — CID 136593990
CID 136593990 (PubChem CID 136593990) has the molecular formula C21H25BN5O3 and a molecular weight of 406.28 g/mol.
| Compound Name | CID 136593990 |
|---|---|
| PubChem CID | 136593990 |
| Molecular Formula | C21H25BN5O3 |
| Molecular Weight | 406.28 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | — |
| SMILES | C[B]c1cnn2c(NCCCNC(=O)C3CCOC3)cc(-c3ccccc3O)nc12 |
| InChI | InChI=1S/C21H25BN5O3/c1-22-16-12-25-27-19(23-8-4-9-24-21(29)14-7-10-30-13-14)11-17(26-20(16)27)15-5-2-3-6-18(15)28/h2-3,5-6,11-12,14,23,28H,4,7-10,13H2,1H3,(H,24,29) |
| InChIKey | BTCQNCUXFSDWCA-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.28 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|