C25H27BN5O2S — CID 136633878
CID 136633878 (PubChem CID 136633878) has the molecular formula C25H27BN5O2S and a molecular weight of 472.40 g/mol.
| Compound Name | CID 136633878 |
|---|---|
| PubChem CID | 136633878 |
| Molecular Formula | C25H27BN5O2S |
| Molecular Weight | 472.40 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | — |
| SMILES | C[B]c1cnn2c(NCC3CCN(C(=O)Cc4ccsc4)CC3)cc(-c3ccccc3O)nc12 |
| InChI | InChI=1S/C25H27BN5O2S/c1-26-20-15-28-31-23(13-21(29-25(20)31)19-4-2-3-5-22(19)32)27-14-17-6-9-30(10-7-17)24(33)12-18-8-11-34-16-18/h2-5,8,11,13,15-17,27,32H,6-7,9-10,12,14H2,1H3 |
| InChIKey | SXMTWXPZLQBFHR-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 82.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.40 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|