C14H15N5O3 — CID 136596996
3-[6-(1-prop-2-enoylpyrrolidin-3-yl)oxy-2-pyridinyl]-1,4-dihydro-1,2,4-triazol-5-one (PubChem CID 136596996) has the molecular formula C14H15N5O3 and a molecular weight of 301.31 g/mol. Its IUPAC name is 3-[6-(1-prop-2-enoylpyrrolidin-3-yl)oxy-2-pyridinyl]-1,4-dihydro-1,2,4-triazol-5-one.
| Compound Name | 3-[6-(1-prop-2-enoylpyrrolidin-3-yl)oxy-2-pyridinyl]-1,4-dihydro-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 136596996 |
| Molecular Formula | C14H15N5O3 |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 3-[6-(1-prop-2-enoylpyrrolidin-3-yl)oxy-2-pyridinyl]-1,4-dihydro-1,2,4-triazol-5-one |
| SMILES | C=CC(=O)N1CCC(Oc2cccc(-c3n[nH]c(=O)[nH]3)n2)C1 |
| InChI | InChI=1S/C14H15N5O3/c1-2-12(20)19-7-6-9(8-19)22-11-5-3-4-10(15-11)13-16-14(21)18-17-13/h2-5,9H,1,6-8H2,(H2,16,17,18,21) |
| InChIKey | RITRWFUHKPESFH-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 103.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|