C17H16N2O4 — CID 145063661
(3S)-3-[[6-(3-formylphenyl)-2-pyridinyl]oxy]pyrrolidine-1-carboxylic acid (PubChem CID 145063661) has the molecular formula C17H16N2O4 and a molecular weight of 312.33 g/mol. Its IUPAC name is (3S)-3-[[6-(3-formylphenyl)-2-pyridinyl]oxy]pyrrolidine-1-carboxylic acid.
| Compound Name | (3S)-3-[[6-(3-formylphenyl)-2-pyridinyl]oxy]pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 145063661 |
| Molecular Formula | C17H16N2O4 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | (3S)-3-[[6-(3-formylphenyl)-2-pyridinyl]oxy]pyrrolidine-1-carboxylic acid |
| SMILES | O=Cc1cccc(-c2cccc(O[C@H]3CCN(C(=O)O)C3)n2)c1 |
| InChI | InChI=1S/C17H16N2O4/c20-11-12-3-1-4-13(9-12)15-5-2-6-16(18-15)23-14-7-8-19(10-14)17(21)22/h1-6,9,11,14H,7-8,10H2,(H,21,22)/t14-/m0/s1 |
| InChIKey | JFXLMOSBGBWDLG-AWEZNQCLSA-N |
| XLogP | 2.69 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|