C27H28N2O4 — CID 136601215
4-[(4-heptylphenyl)diazenyl]anthracene-1,3,9,10-tetrol (PubChem CID 136601215) has the molecular formula C27H28N2O4 and a molecular weight of 444.53 g/mol. Its IUPAC name is 4-[(4-heptylphenyl)diazenyl]anthracene-1,3,9,10-tetrol.
| Compound Name | 4-[(4-heptylphenyl)diazenyl]anthracene-1,3,9,10-tetrol |
|---|---|
| PubChem CID | 136601215 |
| Molecular Formula | C27H28N2O4 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | 4-[(4-heptylphenyl)diazenyl]anthracene-1,3,9,10-tetrol |
| SMILES | CCCCCCCc1ccc(/N=N/c2c(O)cc(O)c3c(O)c4ccccc4c(O)c23)cc1 |
| InChI | InChI=1S/C27H28N2O4/c1-2-3-4-5-6-9-17-12-14-18(15-13-17)28-29-25-22(31)16-21(30)23-24(25)27(33)20-11-8-7-10-19(20)26(23)32/h7-8,10-16,30-33H,2-6,9H2,1H3/b29-28+ |
| InChIKey | ZXWJSRNMLHYUQD-ZQHSETAFSA-N |
| XLogP | 7.74 |
| TPSA | 105.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|