C19H21N3O5 — CID 136601897
6,7-bis(2-methoxyethoxy)-2-pyridin-3-yl-3H-quinazolin-4-one (PubChem CID 136601897) has the molecular formula C19H21N3O5 and a molecular weight of 371.39 g/mol. Its IUPAC name is 6,7-bis(2-methoxyethoxy)-2-pyridin-3-yl-3H-quinazolin-4-one.
| Compound Name | 6,7-bis(2-methoxyethoxy)-2-pyridin-3-yl-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 136601897 |
| Molecular Formula | C19H21N3O5 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 6,7-bis(2-methoxyethoxy)-2-pyridin-3-yl-3H-quinazolin-4-one |
| SMILES | COCCOc1cc2nc(-c3cccnc3)[nH]c(=O)c2cc1OCCOC |
| InChI | InChI=1S/C19H21N3O5/c1-24-6-8-26-16-10-14-15(11-17(16)27-9-7-25-2)21-18(22-19(14)23)13-4-3-5-20-12-13/h3-5,10-12H,6-9H2,1-2H3,(H,21,22,23) |
| InChIKey | FRRXAWXBUGYJFJ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 95.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|