C21H25N5O3 — CID 136606528
3-(2,4-dihydroxy-5-propan-2-ylphenyl)-4-[[4-[(dimethylhydrazinylidene)methyl]phenyl]methyl]-1H-1,2,4-triazol-5-one (PubChem CID 136606528) has the molecular formula C21H25N5O3 and a molecular weight of 395.46 g/mol. Its IUPAC name is 3-(2,4-dihydroxy-5-propan-2-ylphenyl)-4-[[4-[(dimethylhydrazinylidene)methyl]phenyl]methyl]-1H-1,2,4-triazol-5-one.
| Compound Name | 3-(2,4-dihydroxy-5-propan-2-ylphenyl)-4-[[4-[(dimethylhydrazinylidene)methyl]phenyl]methyl]-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 136606528 |
| Molecular Formula | C21H25N5O3 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | 3-(2,4-dihydroxy-5-propan-2-ylphenyl)-4-[[4-[(dimethylhydrazinylidene)methyl]phenyl]methyl]-1H-1,2,4-triazol-5-one |
| SMILES | CC(C)c1cc(-c2n[nH]c(=O)n2Cc2ccc(C=NN(C)C)cc2)c(O)cc1O |
| InChI | InChI=1S/C21H25N5O3/c1-13(2)16-9-17(19(28)10-18(16)27)20-23-24-21(29)26(20)12-15-7-5-14(6-8-15)11-22-25(3)4/h5-11,13,27-28H,12H2,1-4H3,(H,24,29) |
| InChIKey | AYIZABVKEXTDEW-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 106.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|