C25H33N5O9 — CID 136608681
2-amino-5-[[1-(4,5-dimethoxy-2-nitrophenyl)-2,2-dimethylpropoxy]methyl]-7-[(2R,4R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-pyrrolo[2,3-d]pyrimidin-4-one (PubChem CID 136608681) has the molecular formula C25H33N5O9 and a molecular weight of 547.57 g/mol. Its IUPAC name is 2-amino-5-[[1-(4,5-dimethoxy-2-nitrophenyl)-2,2-dimethylpropoxy]methyl]-7-[(2R,4R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-pyrrolo[2,3-d]pyrimidin-4-one.
| Compound Name | 2-amino-5-[[1-(4,5-dimethoxy-2-nitrophenyl)-2,2-dimethylpropoxy]methyl]-7-[(2R,4R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-pyrrolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 136608681 |
| Molecular Formula | C25H33N5O9 |
| Molecular Weight | 547.57 g/mol |
| Exact Mass | 547.23 |
| IUPAC Name | 2-amino-5-[[1-(4,5-dimethoxy-2-nitrophenyl)-2,2-dimethylpropoxy]methyl]-7-[(2R,4R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-pyrrolo[2,3-d]pyrimidin-4-one |
| SMILES | COc1cc(C(OCc2cn([C@H]3C[C@@H](O)[C@@H](CO)O3)c3nc(N)[nH]c(=O)c23)C(C)(C)C)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C25H33N5O9/c1-25(2,3)21(13-6-16(36-4)17(37-5)7-14(13)30(34)35)38-11-12-9-29(19-8-15(32)18(10-31)39-19)22-20(12)23(33)28-24(26)27-22/h6-7,9,15,18-19,21,31-32H,8,10-11H2,1-5H3,(H3,26,27,28,33)/t15-,18-,19-,21?/m1/s1 |
| InChIKey | AVZYRPSFUCJANG-SXQAMMNBSA-N |
| XLogP | 2.18 |
| TPSA | 197.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.57 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|