C29H27FN8O6 — CID 136610229
3-benzyl-5-[3-[(2-fluoro-4,5-dimethoxyphenyl)-[4-(N'-hydroxycarbamimidoyl)anilino]methyl]-5-oxo-4H-1,2,4-triazol-1-yl]imidazole-4-carboxylic acid (PubChem CID 136610229) has the molecular formula C29H27FN8O6 and a molecular weight of 602.58 g/mol. Its IUPAC name is 3-benzyl-5-[3-[(2-fluoro-4,5-dimethoxyphenyl)-[4-(N'-hydroxycarbamimidoyl)anilino]methyl]-5-oxo-4H-1,2,4-triazol-1-yl]imidazole-4-carboxylic acid.
| Compound Name | 3-benzyl-5-[3-[(2-fluoro-4,5-dimethoxyphenyl)-[4-(N'-hydroxycarbamimidoyl)anilino]methyl]-5-oxo-4H-1,2,4-triazol-1-yl]imidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 136610229 |
| Molecular Formula | C29H27FN8O6 |
| Molecular Weight | 602.58 g/mol |
| Exact Mass | 602.20 |
| IUPAC Name | 3-benzyl-5-[3-[(2-fluoro-4,5-dimethoxyphenyl)-[4-(N'-hydroxycarbamimidoyl)anilino]methyl]-5-oxo-4H-1,2,4-triazol-1-yl]imidazole-4-carboxylic acid |
| SMILES | COc1cc(F)c(C(Nc2ccc(C(N)=NO)cc2)c2nn(-c3ncn(Cc4ccccc4)c3C(=O)O)c(=O)[nH]2)cc1OC |
| InChI | InChI=1S/C29H27FN8O6/c1-43-21-12-19(20(30)13-22(21)44-2)23(33-18-10-8-17(9-11-18)25(31)36-42)26-34-29(41)38(35-26)27-24(28(39)40)37(15-32-27)14-16-6-4-3-5-7-16/h3-13,15,23,33,42H,14H2,1-2H3,(H2,31,36)(H,39,40)(H,34,35,41) |
| InChIKey | QLESAAWCKCEMCW-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 194.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.58 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|