C26H23F4N7O5 — CID 140522219
[5-[[[1-(2-aminophenyl)-5-oxo-4H-1,2,4-triazol-3-yl]-(2-fluoro-4,5-dimethoxyphenyl)methyl]amino]-2-carbamimidoylphenyl] 2,2,2-trifluoroacetate (PubChem CID 140522219) has the molecular formula C26H23F4N7O5 and a molecular weight of 589.51 g/mol. Its IUPAC name is [5-[[[1-(2-aminophenyl)-5-oxo-4H-1,2,4-triazol-3-yl]-(2-fluoro-4,5-dimethoxyphenyl)methyl]amino]-2-carbamimidoylphenyl] 2,2,2-trifluoroacetate.
| Compound Name | [5-[[[1-(2-aminophenyl)-5-oxo-4H-1,2,4-triazol-3-yl]-(2-fluoro-4,5-dimethoxyphenyl)methyl]amino]-2-carbamimidoylphenyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 140522219 |
| Molecular Formula | C26H23F4N7O5 |
| Molecular Weight | 589.51 g/mol |
| Exact Mass | 589.17 |
| IUPAC Name | [5-[[[1-(2-aminophenyl)-5-oxo-4H-1,2,4-triazol-3-yl]-(2-fluoro-4,5-dimethoxyphenyl)methyl]amino]-2-carbamimidoylphenyl] 2,2,2-trifluoroacetate |
| SMILES | [H]/N=C(\N)c1ccc(NC(c2nn(-c3ccccc3N)c(=O)[nH]2)c2cc(OC)c(OC)cc2F)cc1OC(=O)C(F)(F)F |
| InChI | InChI=1S/C26H23F4N7O5/c1-40-19-10-14(15(27)11-20(19)41-2)21(23-35-25(39)37(36-23)17-6-4-3-5-16(17)31)34-12-7-8-13(22(32)33)18(9-12)42-24(38)26(28,29)30/h3-11,21,34H,31H2,1-2H3,(H3,32,33)(H,35,36,39) |
| InChIKey | QHVQFNYCXKFWLC-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 183.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.51 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|