C30H34N6O8 — CID 140522199
[2-carbamimidoyl-5-[[[3,5-dimethoxy-4-(2-methoxyethoxy)phenyl]-[1-(2-methoxyphenyl)-5-oxo-4H-1,2,4-triazol-3-yl]methyl]amino]phenyl] acetate (PubChem CID 140522199) has the molecular formula C30H34N6O8 and a molecular weight of 606.64 g/mol. Its IUPAC name is [2-carbamimidoyl-5-[[[3,5-dimethoxy-4-(2-methoxyethoxy)phenyl]-[1-(2-methoxyphenyl)-5-oxo-4H-1,2,4-triazol-3-yl]methyl]amino]phenyl] acetate.
| Compound Name | [2-carbamimidoyl-5-[[[3,5-dimethoxy-4-(2-methoxyethoxy)phenyl]-[1-(2-methoxyphenyl)-5-oxo-4H-1,2,4-triazol-3-yl]methyl]amino]phenyl] acetate |
|---|---|
| PubChem CID | 140522199 |
| Molecular Formula | C30H34N6O8 |
| Molecular Weight | 606.64 g/mol |
| Exact Mass | 606.24 |
| IUPAC Name | [2-carbamimidoyl-5-[[[3,5-dimethoxy-4-(2-methoxyethoxy)phenyl]-[1-(2-methoxyphenyl)-5-oxo-4H-1,2,4-triazol-3-yl]methyl]amino]phenyl] acetate |
| SMILES | [H]/N=C(\N)c1ccc(NC(c2cc(OC)c(OCCOC)c(OC)c2)c2nn(-c3ccccc3OC)c(=O)[nH]2)cc1OC(C)=O |
| InChI | InChI=1S/C30H34N6O8/c1-17(37)44-23-16-19(10-11-20(23)28(31)32)33-26(18-14-24(41-4)27(25(15-18)42-5)43-13-12-39-2)29-34-30(38)36(35-29)21-8-6-7-9-22(21)40-3/h6-11,14-16,26,33H,12-13H2,1-5H3,(H3,31,32)(H,34,35,38) |
| InChIKey | MEVPQFXQYXTCDO-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 185.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.64 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|